|
| (R)-2-(2-(tert-butoxy)-2-oxoethyl)pentanoic acid Basic information |
Product Name: | (R)-2-(2-(tert-butoxy)-2-oxoethyl)pentanoic acid | Synonyms: | (R)-2-(2-(tert-butoxy)-2-oxoethyl)pentanoic acid;Brivaracetam Impurity D;Brivaracetam Impurity 5;(R)-2-(2-(tert-butoxy)-2-oxoethyl)pentanoic acid(BR30);Butanedioic acid, propyl-, 4-(1,1-dimethylethyl) ester, (2R)- (9CI);2(R)-propylsuccinic acid 4-tert-butyl ester;Butanedioic acid, propyl-, 4-(1,1-dimethylethyl) ester, (R)- | CAS: | 112106-16-8 | MF: | C11H20O4 | MW: | 216.27 | EINECS: | | Product Categories: | | Mol File: | 112106-16-8.mol | |
| (R)-2-(2-(tert-butoxy)-2-oxoethyl)pentanoic acid Chemical Properties |
Boiling point | 314.5±25.0 °C(Predicted) | density | 1.036±0.06 g/cm3(Predicted) | pka | 4.50±0.23(Predicted) | InChI | InChI=1S/C11H20O4/c1-5-6-8(10(13)14)7-9(12)15-11(2,3)4/h8H,5-7H2,1-4H3,(H,13,14)/t8-/m1/s1 | InChIKey | FPXXLDXAXQPOIJ-MRVPVSSYSA-N | SMILES | C(O)(=O)[C@H](CCC)CC(OC(C)(C)C)=O |
| (R)-2-(2-(tert-butoxy)-2-oxoethyl)pentanoic acid Usage And Synthesis |
Uses | (2R)??-Propyl-??butanedioic Acid 4-??(1,??1-??Dimethylethyl) Ester is an intermediate in synthesizing Brivaracetam-d7 (B677647). It is a labeled analogue of Brivaracetam, which is a 4-n-propyl analog of levetiracetam (L331500). It is also a racetam derivative with anticonvulsant properties. |
| (R)-2-(2-(tert-butoxy)-2-oxoethyl)pentanoic acid Preparation Products And Raw materials |
|