|
|
| | 3,5-DIBENZYLOXYBENZOIC ACID Basic information |
| Product Name: | 3,5-DIBENZYLOXYBENZOIC ACID | | Synonyms: | RARECHEM AL BE 0734;3,5-BIS(BENZYLOXY)BENZENECARBOXYLIC ACID;3,5-BIS(BENZYLOXY)BENZOIC ACID;3,5-DIBENZYLOXYBENZOIC ACID;3,5-bis(phenylmethoxy)benzoic acid;3,5-DIBENZYLOXYBENZOIC ACID 98+%;3,5-DibenzyloxybenzoicAcid>;Benzoic acid, 3,5-bis(phenylmethoxy)- | | CAS: | 28917-43-3 | | MF: | C21H18O4 | | MW: | 334.37 | | EINECS: | 249-311-5 | | Product Categories: | Organic acids;Building Blocks for Dendrimers;Functional Materials;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts | | Mol File: | 28917-43-3.mol |  |
| | 3,5-DIBENZYLOXYBENZOIC ACID Chemical Properties |
| Melting point | 214 °C | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Dimethylformamide | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C21H18O4/c22-21(23)18-11-19(24-14-16-7-3-1-4-8-16)13-20(12-18)25-15-17-9-5-2-6-10-17/h1-13H,14-15H2,(H,22,23) | | InChIKey | DHQIBPUGSWVDOH-UHFFFAOYSA-N | | SMILES | C1(OCC2=CC=CC=C2)C=C(C=C(OCC2C=CC=CC=2)C=1)C(=O)O | | CAS DataBase Reference | 28917-43-3(CAS DataBase Reference) |
| | 3,5-DIBENZYLOXYBENZOIC ACID Usage And Synthesis |
| Uses | 3,5-Dibenzyloxybenzoic Acid is a reagent used to synthesize (hydroxyphenyl)pyrrolidinylquinolinone as anticancer lead. It is also used to prepare Epi-gallocatechin gallate (EGCG) analogs for treating cancer. |
| | 3,5-DIBENZYLOXYBENZOIC ACID Preparation Products And Raw materials |
|