|
|
| | Dichloro[2,2]paracyclophane Basic information |
| Product Name: | Dichloro[2,2]paracyclophane | | Synonyms: | Dichlorotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene, mixed isomers;PARYLENE C;5,12-Dichlorotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene;DICHLORODI-PARA-XYLYLENE;Dimer, Parylene C;Dichlorotricyclo(8,2,2,2[4,7])hexadeca-4,6,10,12,13,15-hexaene EINCIS;1,4'-Ethylene-1',4-ethylenebis(2-chlorobenzene);5,11-Dichlorotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexene | | CAS: | 10366-05-9 | | MF: | C16H14Cl2 | | MW: | 277.19 | | EINECS: | 233-807-3 | | Product Categories: | | | Mol File: | 10366-05-9.mol | ![Dichloro[2,2]paracyclophane Structure](CAS/GIF/10366-05-9.gif) |
| | Dichloro[2,2]paracyclophane Chemical Properties |
| Melting point | 165-167°C | | Boiling point | 390.0±42.0 °C(Predicted) | | density | 1.229±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C16H14Cl2/c17-15-9-11-1-5-13(15)8-4-12-2-6-14(7-3-11)16(18)10-12/h1-2,5-6,9-10H,3-4,7-8H2 | | InChIKey | NKTYDTSCVMKWHY-UHFFFAOYSA-N | | SMILES | C12C=CC(=C(Cl)C=1)CCC1C=CC(=C(Cl)C=1)CC2 |
| | Dichloro[2,2]paracyclophane Usage And Synthesis |
| Uses | Dichloro-[2,2]-paracyclophane (dichloroPCP) is a valuable monomer for manufacturing polymeric coating used in radioelectronics[1]. | | References | [1] L. L. Gogin. “Ways of Synthesizing Dichloro-[2,2]-Paracyclophane: A Review.” Catalysis in Industry 11 1 (2019): 34–44. |
| | Dichloro[2,2]paracyclophane Preparation Products And Raw materials |
|