- NHBoc-PEG2-amine
-
- $0.00 / 10g
-
2024-03-25
- CAS:153086-78-3
- Min. Order: 10g
- Purity: >98.00%
- Supply Ability: 10g
|
| | Boc-1-amino-3,6-dioxa-8-octanediamine Basic information |
| Product Name: | Boc-1-amino-3,6-dioxa-8-octanediamine | | Synonyms: | TERT-BUTYL 2-[2-(2-AMINOETHOXY)ETHOXY]ETHYLCARBAMATE;N-BOC-3,6-DIOXA-1,8-OCTANEDIAMINE;1-(TERT-BUTYLOXYCARBONYL-AMINO)-3,6-DIOXA-8-OCTANEAMINE, LIQ.;1-(T-BUTYLOXYCARBONYL-AMINO)-3,6-DIOXA-8-OCTANEAMINE, LIQ.;5,8-dioxa-2-azadiheptaoic acid, 10-aMino-,1,1-diMethylethyl ester;Boc-NH-PEG2-CH2CH2NH2;N-Boc- 2,2'-(ethylenedioxy)diethylaMine >=95.0% (NT);CarbaMic acid,N-[2-[2-(2-aMinoethoxy)ethoxy]ethyl]-, 1,1-diMethylethyl ester | | CAS: | 153086-78-3 | | MF: | C11H24N2O4 | | MW: | 248.32 | | EINECS: | | | Product Categories: | peg | | Mol File: | 153086-78-3.mol |  |
| | Boc-1-amino-3,6-dioxa-8-octanediamine Chemical Properties |
| Boiling point | 365.2±27.0 °C(Predicted) | | density | 1.046 g/mL at 20 °C | | refractive index | 1.4570 to 1.4610 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 12.23±0.46(Predicted) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C11H24N2O4/c1-11(2,3)17-10(14)13-5-7-16-9-8-15-6-4-12/h4-9,12H2,1-3H3,(H,13,14) | | InChIKey | OCUICOFGFQENAS-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCCOCCOCCN |
| Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | 2735 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | Ⅲ | | HS Code | 29241990 |
| | Boc-1-amino-3,6-dioxa-8-octanediamine Usage And Synthesis |
| Description | t-Boc-N-Amido-PEG2-amine is a PEG linker containing an amino group and Boc-protected amino group. The hydrophilic PEG spacer increases solubility in aqueous media. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The Boc group can be deprotected under mild acidic conditions to form the free amine. | | Chemical Properties | Light yellow oil | | Uses | Linker reagent for the prep. of a broad variety of linked tags, monomers for polymerisation, ionophores etc., e.g. biotinylation reagents. |
| | Boc-1-amino-3,6-dioxa-8-octanediamine Preparation Products And Raw materials |
|