- 3-Methoxy-2-naphthylboronic acid
-
- $200.00 / 1KG
-
2024-01-02
- CAS:104115-76-6
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 3-Methoxynaphthalene-2-boronic acid Basic information |
| Product Name: | 3-Methoxynaphthalene-2-boronic acid | | Synonyms: | 3-Methoxynaphthalene-2-boronic acid;3-Methoxynaphthalen-2-yl-2-ylboronic acid;3-Methoxy-2-naphthylboronic acid;2-Methoxy-3-naphthaleneboronic acid;3-METHOXY-2-NAPHTHYLBORONIC ACID; 2-METHOXY-3-NAPHTHALENEBORONIC ACID; 3-METHOXYNAPHTHALENE-2-BORONIC ACID;3-Methoxynaphthalene-2-boronic acid 98%;3-methoxynaphthalen-2-boronic acid;3-methoxynaphthalen-2-yl-2-boronic acid | | CAS: | 104115-76-6 | | MF: | C11H11BO3 | | MW: | 202.01 | | EINECS: | | | Product Categories: | | | Mol File: | 104115-76-6.mol |  |
| | 3-Methoxynaphthalene-2-boronic acid Chemical Properties |
| Melting point | 153-155 °C | | Boiling point | 425.2±47.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystals | | pka | 8.53±0.30(Predicted) | | color | Off-white | | InChI | InChI=1S/C11H11BO3/c1-15-11-7-9-5-3-2-4-8(9)6-10(11)12(13)14/h2-7,13-14H,1H3 | | InChIKey | RHNSMLZROCLQBJ-UHFFFAOYSA-N | | SMILES | B(C1=C(OC)C=C2C(=C1)C=CC=C2)(O)O |
| | 3-Methoxynaphthalene-2-boronic acid Usage And Synthesis |
| Uses | 3-Methoxynaphthalene-2-boronic acid can be used as organic synthesis intermediates and pharmaceutical intermediates, which are mainly used in laboratory research and development process and chemical production process. |
| | 3-Methoxynaphthalene-2-boronic acid Preparation Products And Raw materials |
|