2-Methyl-3-biphenylmethanol
2-Methyl-3-biphenylmethanol атрибут
| Температура плавления: |
73-76 °C(lit.) |
| Температура кипения: |
330.9±11.0 °C(Predicted) |
| плотность: |
1.072±0.06 g/cm3(Predicted) |
| температура хранения: |
Sealed in dry,Room Temperature |
| растворимость: |
Хлороформ (Слегка), Метанол (Слегка) |
| пка: |
14.28±0.10(Predicted) |
| форма: |
Твердый |
| цвет: |
От белого до не совсем белого |
| InChI: |
InChI=1S/C14H14O/c1-11-13(10-15)8-5-9-14(11)12-6-3-2-4-7-12/h2-9,15H,10H2,1H3 |
| ИнЧИКей: |
BGTLHJPGBIVQLJ-UHFFFAOYSA-N |
| SMILES: |
C1(C2=CC=CC=C2)=CC=CC(CO)=C1C |
| Справочник по базе данных CAS: |
76350-90-8(CAS DataBase Reference) |
| Система регистрации веществ EPA: |
[1,1'-Biphenyl]-3-methanol, 2-methyl- (76350-90-8) |
Заявления о рисках и безопасности
| WGK Германия |
3 |
| кода HS |
2906290090 |
2-Methyl-3-biphenylmethanol химические свойства, назначение, производство
Описание
2-Methyl-3-biphenylmethanol is a pharmaceutical intermediate and organic chemical synthesis reagent, which can be used in the preparation of drugs such as Bifenthrin and PD-L1 inhibitors, and also in the synthesis of other organic compounds such as 2-methyl-3-phenylphenethylboronic acid pinacol ester, biphenyl-1,2,3-triazole couplings and biphenyl alcohols.
Химические свойства
white to light yellow crystal powde
Использование
Bifenthrin intermediate.
Синтез
Carrying out a Suzuki coupling reaction between 3-bromo-2-methylbenzoic acid and phenyl substituted boric acid or phenyl substituted borate to obtain 3-phenyl-2-methylbenzoic acid, and then carrying out a reduction reaction to obtain 2-Methyl-3-biphenylmethanol, wherein the Suzuki coupling reaction is carried out at 10-150 DEG C for 1-12 hours under the action of an alkali. 3-phenyl-2-methylbenzoic acid can be directly reduced with a reducing agent such as borane and lithium aluminium hydride to obtain 2-Methyl-3-biphenylmethanol.
2-Methyl-3-biphenylmethanol препаратная продукция и сырье
сырьё
препарат
2-Methyl-3-biphenylmethanol поставщик
Global( 259)Suppliers
76350-90-8()подобный поиск: