9-Bromophenanthrene
9-Bromophenanthrene атрибут
| Температура плавления: |
60-64 °C (lit.) |
| Температура кипения: |
180-190 °C/2 mmHg (lit.) |
| плотность: |
1.4251 (rough estimate) |
| показатель преломления: |
1.6404 (estimate) |
| Fp: |
>230 °F |
| температура хранения: |
Sealed in dry,Room Temperature |
| растворимость: |
хлороформ: 50 мг/мл, прозрачный |
| форма: |
пудра |
| цвет: |
Светло-желтого |
| БРН: |
1869927 |
| InChI: |
InChI=1S/C14H9Br/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H |
| ИнЧИКей: |
RSQXKVWKJVUZDG-UHFFFAOYSA-N |
| SMILES: |
C1=C2C(C3C(C(Br)=C2)=CC=CC=3)=CC=C1 |
| Справочник по базе данных CAS: |
573-17-1(CAS DataBase Reference) |
| Рейтинг продуктов питания EWG: |
1 |
| FDA UNII: |
N4XAW27Z35 |
| Справочник по химии NIST: |
Phenanthrene, 9-bromo-(573-17-1) |
| UNSPSC Code: |
12352100 |
| NACRES: |
NA.22 |
безопасность
- Заявления о рисках и безопасности
- код информации об опасности(GHS)
| символ（GHS） |
|
| сигнальное слово |
Warning |
| Заявление об опасности |
| пароль |
Заявление об опасности |
Класс опасности |
категория |
сигнальное слово |
пиктограмма |
предупреждение |
| H315 |
При попадании на кожу вызывает раздражение. |
Разъедание/раздражение кожи |
Категория 2 |
Предупреждение |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
При попадании в глаза вызывает выраженное раздражение. |
Серьезное повреждение/раздражение глаз |
Категория 2А |
Предупреждение |
|
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Может вызывать раздражение верхних дыхательных путей. |
Специфическая токсичность на орган-мишень, однократное воздействие; Раздражение дыхательных путей |
Категория 3 |
Предупреждение |
|
|
|
| Внимание |
| P261 |
Избегать вдыхания пыли/ дыма/ газа/ тумана/ паров/
аэрозолей. |
| P305+P351+P338 |
ПРИ ПОПАДАНИИ В ГЛАЗА: Осторожно промыть глаза водой
в течение нескольких минут. Снять контактные линзы, если
Вы ими пользуетесь и если это легко сделать. Продолжить
промывание глаз. |
|
9-Bromophenanthrene химические свойства, назначение, производство
Описание
9-Bromophenanthrene is a luminescent material that fluoresces at short wavelengths and can be used as a molecular probe to detect the presence of other compounds and the mechanism of reaction, among other things.
Химические свойства
light yellow powder. soluble in toluene, and chloroform (50 mg/ml).
Использование
9-Bromophenanthrene is used as halogenated building block. Isotope labelled 9-Bromophenanthrene (B687200), a halogenated polycyclic aromatic hydrocarbon that has been seen to have a room temperature phosphorescence that can be induced by β-cyclodextrin (β-CD) in the presence of cyclohexane; however, trace Fe(III) causes a decrease of the RTP emission.
Подготовка
9-Bromophenanthrene (90-94%) is produced by adding bromine to a refluxing solution of phenanthrene in carbon tetrachloride. This is the starting-point of 9-substituted phenanthrenes, e.g, when heated with cuprous cyanide at 260℃, 9-bromophenanthrene forms the corresponding cyano-compound; this may be hydrolysed to phenanthrene-9-carboxylic acid. Phenanthrene undergoes the Friedel-Crafts reaction mainly in the 3-, and to a small extent, in the 2-position. It is chloromethylated in the 9-position. When nitrated, phenanthrene gives a mixture of three mononitro-derivatives, the 3-isomer predominating. Sulphonation of phenanthrene gives a mixture of 1-, 2-, 3- and 9-phenanthrenesulphonic acids, and the ratio of these isomers depends on the temperature.
9-Bromophenanthrene препаратная продукция и сырье
сырьё
препарат
9-Bromophenanthrene поставщик
Global( 309)Suppliers
573-17-1(9-Bromophenanthrene)подобный поиск: