Этил (S)-(-)-4-хлор-3-гидроксибутират
Этил (S)-(-)-4-хлор-3-гидроксибутират атрибут
| альфа: |
-14.5 º (c=neat) |
| Температура кипения: |
93-95 °C5 mm Hg(lit.) |
| плотность: |
1.19 g/mL at 25 °C(lit.) |
| показатель преломления: |
n20/D 1.453(lit.) |
| Fp: |
109 °C |
| температура хранения: |
Keep in dark place,Sealed in dry,Room Temperature |
| пка: |
13.23±0.20(Predicted) |
| форма: |
жидкость |
| цвет: |
От бесцветного до желтого |
| оптическая активность: |
[α]23/D 14°, neat |
| БРН: |
4657170 |
| InChI: |
InChI=1S/C6H11ClO3/c1-2-10-6(9)3-5(8)4-7/h5,8H,2-4H2,1H3/t5-/m0/s1 |
| ИнЧИКей: |
ZAJNMXDBJKCCAT-YFKPBYRVSA-N |
| SMILES: |
C(OCC)(=O)C[C@H](O)CCl |
| Справочник по базе данных CAS: |
86728-85-0(CAS DataBase Reference) |
Этил (S)-(-)-4-хлор-3-гидроксибутират химические свойства, назначение, производство
Химические свойства
Colorless to light yellow liqui
Использование
Atorvastatin Intermediate
Биосинтез
Bioreductions catalyzed by alcohol dehydrogenases (ADHs) play an essential role in synthesizing chiral alcohols. A novel ADH, SmADH31, obtained from the Stenotrophomonas maltophilia genome, which can tolerate extremely high concentrations (6 M) of both substrate and product. The coexpression of SmADH31 and glucose dehydrogenase from Bacillus subtilis in Escherichia coli meant that as much as 660 g L–1 (4.0 M) ethyl 4-chloroacetoacetate was completely converted into ethyl (S)-4-chloro-3-hydroxybutyrate [(S)-CHBE] in a monophasic aqueous system with a >99.9% ee value and a high space-time yield (2664 g L–1 d–1). In the 100 ml-scale monophasic aqueous system (in triplicate), 66.0 g COBE (single batch charge) can be completely converted to (S)-CHBE (ee >99.9%) in only 6 h with 2 g of the SmADH31/GDH co-expressing cells. After extraction and evaporation, 61.6 g (S)-CHBE was isolated with 92% yield[1].
Общее описание
Ethyl (S)-4-chloro-3-hydroxybutanoate is a chiral intermediate generally used to prepare atorvastatin, a cholesterol-lowering drug.
Этил (S)-(-)-4-хлор-3-гидроксибутират препаратная продукция и сырье
сырьё
препарат
Этил (S)-(-)-4-хлор-3-гидроксибутират поставщик
Global( 369)Suppliers
86728-85-0(Этил (S)-(-)-4-хлор-3-гидроксибутират)подобный поиск: