- Magnesium L-Threonate
-
- $0.00 / 1kg
-
2024-09-14
- CAS:778571-57-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20MT
|
| Product Name: | Magnesium L-Threonate | | Synonyms: | Bis[(2R,3S)-2,3,4-trihydroxybutanoato-alphaO,alphaO']magnesium;L-Threonic acid magnesium salt;Magnesium (2R,3S)-2,3,4-trihydroxybutanoate;-2,3,4-trihydroxybutanoate;Magnesium (2R,3S);L-Threonic acid magnisium salt;Magnesium L-threonate Company Standards;Factory Supply Magnesium L-Threonate | | CAS: | 778571-57-6 | | MF: | C8H14MgO10 | | MW: | 294.5 | | EINECS: | 1312995-182-4 | | Product Categories: | api;778571-57-6 | | Mol File: | 778571-57-6.mol |  |
| | Magnesium L-Threonate Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | form | Solid | | color | White to off-white | | InChI | InChI=1S/2C4H8O5.Mg/c2*5-1-2(6)3(7)4(8)9;/h2*2-3,5-7H,1H2,(H,8,9);/q;;+2/p-2 | | InChIKey | YVJOHOWNFPQSPP-UHFFFAOYSA-L | | SMILES | C(C1=O[Mg+2]2(O=C(C(O)C(O)CO)[O-]2)[O-]1)(O)C(O)CO |
| | Magnesium L-Threonate Usage And Synthesis |
| Physical Form | Solid | | Description | L-Threonic acid magnesium salt (Magnesium L-Threonate) is the enantiomer of Threonic acid and a metabolite of vitamin C. L-Ascorbic acid (L-Ascorbate), an electron donor, is an endogenous antioxidant agent. | | Physical properties | Appearance:White or almost white powder. | | Uses | Magnesium(2+) Ion Bis((2r,3s)-2,3,4-Trihydroxybutanoate) is a useful research chemical. | | Uses | Preclinical work demonstrates that L-Threonic Acid Magnesium Salt (LTAMS) administration is associated with neurobiological and neurofunctional effects that could offer clinical benefits in ADHD treatment. | | Application | Raw material of healthcare products.A Dietary Supplement.Laboratory research | | benefits |
Magnesium L-Threonate could enhance cognition, improve body magnesium status, and reduce fluctuation in cognitive ability, brain anti-ageing, and memory improvement.
|
| | Magnesium L-Threonate Preparation Products And Raw materials |
|