Dmt-2'-f-dc(ac) amidite manufacturers
|
| | Dmt-2'-f-dc(ac) amidite Basic information |
| Product Name: | Dmt-2'-f-dc(ac) amidite | | Synonyms: | DMT-2'-F-DC(AC) AMIDITE 0.25G, AB, SINGL;DMT-2'-F-DC(AC) AMIDITE 0.25G 89 SINGL;2’-F-rC(N-Ac) Phosphoramidite;5'-O-DMT-2'-F-dC(N-Ac)-3'-CEDPA;N-Acetyl-5'-O-(4,4-dimethoxytrityl)-2'-deoxy-2'-fluorocytidine-3'-(2-cyanoethyl-N,N-diisopropyl)phosphoramidite;2'-F-Ac-dC Phosphoramidite;N4-Acetyl-2'-deoxy-5'-O-DMT-2'-fluorocytidine 3'-CE phosphoramidite;DMT-2′Fluoro-dC(ac) Phosphoramidite | | CAS: | 159414-99-0 | | MF: | C41H49FN5O8P | | MW: | 789.83 | | EINECS: | 2017-001-1 | | Product Categories: | Amidite | | Mol File: | 159414-99-0.mol |  |
| | Dmt-2'-f-dc(ac) amidite Chemical Properties |
| storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | DMSO: 100 mg/mL (126.61 mM) | | form | powder | | pka | 10.11±0.20(Predicted) | | color | white to off-white | | InChIKey | CNFKJHKDSRXNFL-XSLLURDHNA-N | | SMILES | N1([C@@H]2O[C@@H]([C@@H](OP(N(C(C)C)C(C)C)OCCC#N)[C@H]2F)COC(C2=CC=CC=C2)(C2=CC=C(OC)C=C2)C2C=CC(OC)=CC=2)C=CC(=NC1=O)NC(C)=O |&1:1,3,4,19,r| |
| WGK Germany | 3 | | HS Code | 2934999090 |
| | Dmt-2'-f-dc(ac) amidite Usage And Synthesis |
| Uses | Dmt-2''-f-dc(ac) amidite (CAS# 159414-99-0) is a nucleotide used in the preparation of cell-penetrating and neurotargeting dendritic siRNA nanostructures. |
| | Dmt-2'-f-dc(ac) amidite Preparation Products And Raw materials |
|